About 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride
2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride (PubChem CID 14229736) has the molecular formula C21H22ClNO3
and a molecular weight of 371.86 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride |
| PubChem CID | 14229736 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCCN1CCCC1)c1cccc2cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C21H21NO3.ClH/c23-21(24-14-13-22-11-4-5-12-22)18-10-6-9-17-15-19(25-20(17)18)16-7-2-1-3-8-16;/h1-3,6-10,15H,4-5,11-14H2;1H |
| InChIKey | JOXUFWUMLFTCIN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride?
The IUPAC name of 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride (CID 14229736) is 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride.
What is the SMILES notation for 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride?
The canonical SMILES for 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride is Cl.O=C(OCCN1CCCC1)c1cccc2cc(-c3ccccc3)oc12.
What is the InChIKey of 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride?
The InChIKey is JOXUFWUMLFTCIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO3.ClH/c23-21(24-14-13-22-11-4-5-12-22)18-10-6-9-17-15-19(25-20(17)18)16-7-2-1-3-8-16;/h1-3,6-10,15H,4-5,11-14H2;1H.
What are the key properties of 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride?
2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride has a molecular weight of 371.86 g/mol, XLogP of 4.77, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylethyl 2-phenyl-1-benzofuran-7-carboxylate;hydrochloride is sourced from PubChem (CID 14229736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).