C23H23NO5 — CID 18967
2-morpholin-4-ylethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate (PubChem CID 18967) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate.
| Compound Name | 2-morpholin-4-ylethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|---|
| PubChem CID | 18967 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-morpholin-4-ylethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)OCCN3CCOCC3)cccc2c1=O |
| InChI | InChI=1S/C23H23NO5/c1-16-20(25)18-8-5-9-19(22(18)29-21(16)17-6-3-2-4-7-17)23(26)28-15-12-24-10-13-27-14-11-24/h2-9H,10-15H2,1H3 |
| InChIKey | BFHKLVWZDHRVQW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |