C21H18O4 — CID 18098557
2-methylprop-2-enyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate (PubChem CID 18098557) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-methylprop-2-enyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate.
| Compound Name | 2-methylprop-2-enyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|---|
| PubChem CID | 18098557 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-methylprop-2-enyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
| SMILES | C=C(C)COC(=O)c1cccc2c(=O)c(C)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C21H18O4/c1-13(2)12-24-21(23)17-11-7-10-16-18(22)14(3)19(25-20(16)17)15-8-5-4-6-9-15/h4-11H,1,12H2,2-3H3 |
| InChIKey | OILMYGQCXHESSO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|