C28H25NO5 — CID 16505519
[2-oxo-2-(2-propan-2-ylanilino)ethyl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate (PubChem CID 16505519) has the molecular formula C28H25NO5 and a molecular weight of 455.51 g/mol. Its IUPAC name is [2-oxo-2-(2-propan-2-ylanilino)ethyl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate.
| Compound Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|---|
| PubChem CID | 16505519 |
| Molecular Formula | C28H25NO5 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)OCC(=O)Nc3ccccc3C(C)C)cccc2c1=O |
| InChI | InChI=1S/C28H25NO5/c1-17(2)20-12-7-8-15-23(20)29-24(30)16-33-28(32)22-14-9-13-21-25(31)18(3)26(34-27(21)22)19-10-5-4-6-11-19/h4-15,17H,16H2,1-3H3,(H,29,30) |
| InChIKey | FJFCDUHVPKHMTM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |