C27H23NO5 — CID 16505437
[2-[(4-methylphenyl)methylamino]-2-oxoethyl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate (PubChem CID 16505437) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate.
| Compound Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|---|
| PubChem CID | 16505437 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
| SMILES | Cc1ccc(CNC(=O)COC(=O)c2cccc3c(=O)c(C)c(-c4ccccc4)oc23)cc1 |
| InChI | InChI=1S/C27H23NO5/c1-17-11-13-19(14-12-17)15-28-23(29)16-32-27(31)22-10-6-9-21-24(30)18(2)25(33-26(21)22)20-7-4-3-5-8-20/h3-14H,15-16H2,1-2H3,(H,28,29) |
| InChIKey | LIKQCUQZYQYKNV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |