C20H18O5 — CID 46642244
2-methoxyethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate (PubChem CID 46642244) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-methoxyethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate.
| Compound Name | 2-methoxyethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|---|
| PubChem CID | 46642244 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-methoxyethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
| SMILES | COCCOC(=O)c1cccc2c(=O)c(C)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C20H18O5/c1-13-17(21)15-9-6-10-16(20(22)24-12-11-23-2)19(15)25-18(13)14-7-4-3-5-8-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | PECWSGKVGGJAAW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|