C25H28ClNO4 — CID 3070434
1-piperidin-1-ylpropan-2-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride (PubChem CID 3070434) has the molecular formula C25H28ClNO4 and a molecular weight of 441.96 g/mol. Its IUPAC name is 1-piperidin-1-ylpropan-2-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride.
| Compound Name | 1-piperidin-1-ylpropan-2-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 3070434 |
| Molecular Formula | C25H28ClNO4 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-piperidin-1-ylpropan-2-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)OC(C)CN3CCCCC3)cccc2c1=O.Cl |
| InChI | InChI=1S/C25H27NO4.ClH/c1-17(16-26-14-7-4-8-15-26)29-25(28)21-13-9-12-20-22(27)18(2)23(30-24(20)21)19-10-5-3-6-11-19;/h3,5-6,9-13,17H,4,7-8,14-16H2,1-2H3;1H |
| InChIKey | RBBVSTUTCNTARR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |