C24H28ClNO5 — CID 23615729
3-methyl-4-oxo-2-phenylchromene-8-carboxylic acid;1-piperidin-1-ylethanol;hydrochloride (PubChem CID 23615729) has the molecular formula C24H28ClNO5 and a molecular weight of 445.94 g/mol. Its IUPAC name is 3-methyl-4-oxo-2-phenylchromene-8-carboxylic acid;1-piperidin-1-ylethanol;hydrochloride.
| Compound Name | 3-methyl-4-oxo-2-phenylchromene-8-carboxylic acid;1-piperidin-1-ylethanol;hydrochloride |
|---|---|
| PubChem CID | 23615729 |
| Molecular Formula | C24H28ClNO5 |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 3-methyl-4-oxo-2-phenylchromene-8-carboxylic acid;1-piperidin-1-ylethanol;hydrochloride |
| SMILES | CC(O)N1CCCCC1.Cc1c(-c2ccccc2)oc2c(C(=O)O)cccc2c1=O.Cl |
| InChI | InChI=1S/C17H12O4.C7H15NO.ClH/c1-10-14(18)12-8-5-9-13(17(19)20)16(12)21-15(10)11-6-3-2-4-7-11;1-7(9)8-5-3-2-4-6-8;/h2-9H,1H3,(H,19,20);7,9H,2-6H2,1H3;1H |
| InChIKey | ZGRIJFSWONWWJV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |