C25H19NO3 — CID 166196840
8-(1,3-dihydroisoindole-2-carbonyl)-3-methyl-2-phenylchromen-4-one (PubChem CID 166196840) has the molecular formula C25H19NO3 and a molecular weight of 381.43 g/mol. Its IUPAC name is 8-(1,3-dihydroisoindole-2-carbonyl)-3-methyl-2-phenylchromen-4-one.
| Compound Name | 8-(1,3-dihydroisoindole-2-carbonyl)-3-methyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 166196840 |
| Molecular Formula | C25H19NO3 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 8-(1,3-dihydroisoindole-2-carbonyl)-3-methyl-2-phenylchromen-4-one |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)N3Cc4ccccc4C3)cccc2c1=O |
| InChI | InChI=1S/C25H19NO3/c1-16-22(27)20-12-7-13-21(24(20)29-23(16)17-8-3-2-4-9-17)25(28)26-14-18-10-5-6-11-19(18)15-26/h2-13H,14-15H2,1H3 |
| InChIKey | SDTOOIPQSRXKBS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |