C27H23ClN2O3 — CID 26696208
8-[4-(3-chlorophenyl)piperazine-1-carbonyl]-3-methyl-2-phenylchromen-4-one (PubChem CID 26696208) has the molecular formula C27H23ClN2O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is 8-[4-(3-chlorophenyl)piperazine-1-carbonyl]-3-methyl-2-phenylchromen-4-one.
| Compound Name | 8-[4-(3-chlorophenyl)piperazine-1-carbonyl]-3-methyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 26696208 |
| Molecular Formula | C27H23ClN2O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 8-[4-(3-chlorophenyl)piperazine-1-carbonyl]-3-methyl-2-phenylchromen-4-one |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)N3CCN(c4cccc(Cl)c4)CC3)cccc2c1=O |
| InChI | InChI=1S/C27H23ClN2O3/c1-18-24(31)22-11-6-12-23(26(22)33-25(18)19-7-3-2-4-8-19)27(32)30-15-13-29(14-16-30)21-10-5-9-20(28)17-21/h2-12,17H,13-16H2,1H3 |
| InChIKey | KPUSBHQSHZUMQH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |