C22H21NO4 — CID 78802519
8-(4-hydroxypiperidine-1-carbonyl)-3-methyl-2-phenylchromen-4-one (PubChem CID 78802519) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 8-(4-hydroxypiperidine-1-carbonyl)-3-methyl-2-phenylchromen-4-one.
| Compound Name | 8-(4-hydroxypiperidine-1-carbonyl)-3-methyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 78802519 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 8-(4-hydroxypiperidine-1-carbonyl)-3-methyl-2-phenylchromen-4-one |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)N3CCC(O)CC3)cccc2c1=O |
| InChI | InChI=1S/C22H21NO4/c1-14-19(25)17-8-5-9-18(22(26)23-12-10-16(24)11-13-23)21(17)27-20(14)15-6-3-2-4-7-15/h2-9,16,24H,10-13H2,1H3 |
| InChIKey | WNFGAJGFCGEQHP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |