C30H28N2O4 — CID 32769378
8-[4-(4-ethylbenzoyl)piperazine-1-carbonyl]-3-methyl-2-phenylchromen-4-one (PubChem CID 32769378) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is 8-[4-(4-ethylbenzoyl)piperazine-1-carbonyl]-3-methyl-2-phenylchromen-4-one.
| Compound Name | 8-[4-(4-ethylbenzoyl)piperazine-1-carbonyl]-3-methyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 32769378 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 8-[4-(4-ethylbenzoyl)piperazine-1-carbonyl]-3-methyl-2-phenylchromen-4-one |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)c3cccc4c(=O)c(C)c(-c5ccccc5)oc34)CC2)cc1 |
| InChI | InChI=1S/C30H28N2O4/c1-3-21-12-14-23(15-13-21)29(34)31-16-18-32(19-17-31)30(35)25-11-7-10-24-26(33)20(2)27(36-28(24)25)22-8-5-4-6-9-22/h4-15H,3,16-19H2,1-2H3 |
| InChIKey | SULNAILFJZWNQA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |