C28H27N2O3+ — CID 2406363
8-(4-benzylpiperazin-4-ium-1-carbonyl)-3-methyl-2-phenylchromen-4-one (PubChem CID 2406363) has the molecular formula C28H27N2O3+ and a molecular weight of 439.54 g/mol. Its IUPAC name is 8-(4-benzylpiperazin-4-ium-1-carbonyl)-3-methyl-2-phenylchromen-4-one.
| Compound Name | 8-(4-benzylpiperazin-4-ium-1-carbonyl)-3-methyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 2406363 |
| Molecular Formula | C28H27N2O3+ |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 8-(4-benzylpiperazin-4-ium-1-carbonyl)-3-methyl-2-phenylchromen-4-one |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)N3CC[NH+](Cc4ccccc4)CC3)cccc2c1=O |
| InChI | InChI=1S/C28H26N2O3/c1-20-25(31)23-13-8-14-24(27(23)33-26(20)22-11-6-3-7-12-22)28(32)30-17-15-29(16-18-30)19-21-9-4-2-5-10-21/h2-14H,15-19H2,1H3/p+1 |
| InChIKey | KRSQPKOYQFGBET-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 54.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |