C27H30N2O5 — CID 60560484
tert-butyl 4-[(3-methyl-4-oxo-2-phenylchromene-8-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 60560484) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is tert-butyl 4-[(3-methyl-4-oxo-2-phenylchromene-8-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-methyl-4-oxo-2-phenylchromene-8-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 60560484 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | tert-butyl 4-[(3-methyl-4-oxo-2-phenylchromene-8-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)NC3CCN(C(=O)OC(C)(C)C)CC3)cccc2c1=O |
| InChI | InChI=1S/C27H30N2O5/c1-17-22(30)20-11-8-12-21(24(20)33-23(17)18-9-6-5-7-10-18)25(31)28-19-13-15-29(16-14-19)26(32)34-27(2,3)4/h5-12,19H,13-16H2,1-4H3,(H,28,31) |
| InChIKey | YXJOPFJADDEQKM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |