C18H25N3O4 — CID 58602980
tert-butyl 4-(benzoylcarbamoylamino)piperidine-1-carboxylate (PubChem CID 58602980) has the molecular formula C18H25N3O4 and a molecular weight of 347.41 g/mol. Its IUPAC name is tert-butyl 4-(benzoylcarbamoylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(benzoylcarbamoylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58602980 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl 4-(benzoylcarbamoylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H25N3O4/c1-18(2,3)25-17(24)21-11-9-14(10-12-21)19-16(23)20-15(22)13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H2,19,20,22,23) |
| InChIKey | QOKUFIFJOKJOBJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |