C17H24ClN3O3S — CID 45371218
tert-butyl 4-(benzoylcarbamothioyl)piperazine-1-carboxylate;hydrochloride (PubChem CID 45371218) has the molecular formula C17H24ClN3O3S and a molecular weight of 385.92 g/mol. Its IUPAC name is tert-butyl 4-(benzoylcarbamothioyl)piperazine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 4-(benzoylcarbamothioyl)piperazine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 45371218 |
| Molecular Formula | C17H24ClN3O3S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | tert-butyl 4-(benzoylcarbamothioyl)piperazine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=S)NC(=O)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C17H23N3O3S.ClH/c1-17(2,3)23-16(22)20-11-9-19(10-12-20)15(24)18-14(21)13-7-5-4-6-8-13;/h4-8H,9-12H2,1-3H3,(H,18,21,24);1H |
| InChIKey | NWYFRCWPSXXYBI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|