C14H18N4O3S — CID 778911
ethyl 4-(pyridine-3-carbonylcarbamothioyl)piperazine-1-carboxylate (PubChem CID 778911) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is ethyl 4-(pyridine-3-carbonylcarbamothioyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(pyridine-3-carbonylcarbamothioyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 778911 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | ethyl 4-(pyridine-3-carbonylcarbamothioyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=S)NC(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C14H18N4O3S/c1-2-21-14(20)18-8-6-17(7-9-18)13(22)16-12(19)11-4-3-5-15-10-11/h3-5,10H,2,6-9H2,1H3,(H,16,19,22) |
| InChIKey | LBXNGQYFOOMJCQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|