C17H24N4O5S2 — CID 5194152
ethyl 4-[[3-(dimethylsulfamoyl)benzoyl]carbamothioyl]piperazine-1-carboxylate (PubChem CID 5194152) has the molecular formula C17H24N4O5S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is ethyl 4-[[3-(dimethylsulfamoyl)benzoyl]carbamothioyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[3-(dimethylsulfamoyl)benzoyl]carbamothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 5194152 |
| Molecular Formula | C17H24N4O5S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | ethyl 4-[[3-(dimethylsulfamoyl)benzoyl]carbamothioyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=S)NC(=O)c2cccc(S(=O)(=O)N(C)C)c2)CC1 |
| InChI | InChI=1S/C17H24N4O5S2/c1-4-26-17(23)21-10-8-20(9-11-21)16(27)18-15(22)13-6-5-7-14(12-13)28(24,25)19(2)3/h5-7,12H,4,8-11H2,1-3H3,(H,18,22,27) |
| InChIKey | OAHQDXXECIHUOB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|