C18H19ClN2O5S — CID 100625550
ethyl 2-chloro-4-[[3-(dimethylsulfamoyl)benzoyl]amino]benzoate (PubChem CID 100625550) has the molecular formula C18H19ClN2O5S and a molecular weight of 410.88 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[3-(dimethylsulfamoyl)benzoyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[3-(dimethylsulfamoyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 100625550 |
| Molecular Formula | C18H19ClN2O5S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | ethyl 2-chloro-4-[[3-(dimethylsulfamoyl)benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cccc(S(=O)(=O)N(C)C)c2)cc1Cl |
| InChI | InChI=1S/C18H19ClN2O5S/c1-4-26-18(23)15-9-8-13(11-16(15)19)20-17(22)12-6-5-7-14(10-12)27(24,25)21(2)3/h5-11H,4H2,1-3H3,(H,20,22) |
| InChIKey | HBYRKMMCWXJYCY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |