C22H20ClN3O5S — CID 55611031
2-chloro-4-[[3-[(4-methoxyphenyl)-methylsulfamoyl]benzoyl]amino]benzamide (PubChem CID 55611031) has the molecular formula C22H20ClN3O5S and a molecular weight of 473.94 g/mol. Its IUPAC name is 2-chloro-4-[[3-[(4-methoxyphenyl)-methylsulfamoyl]benzoyl]amino]benzamide.
| Compound Name | 2-chloro-4-[[3-[(4-methoxyphenyl)-methylsulfamoyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 55611031 |
| Molecular Formula | C22H20ClN3O5S |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 2-chloro-4-[[3-[(4-methoxyphenyl)-methylsulfamoyl]benzoyl]amino]benzamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C22H20ClN3O5S/c1-26(16-7-9-17(31-2)10-8-16)32(29,30)18-5-3-4-14(12-18)22(28)25-15-6-11-19(21(24)27)20(23)13-15/h3-13H,1-2H3,(H2,24,27)(H,25,28) |
| InChIKey | USNCKBSCYIOZLA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |