C22H20N6O4S — CID 2553279
3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[4-(tetrazol-1-yl)phenyl]benzamide (PubChem CID 2553279) has the molecular formula C22H20N6O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[4-(tetrazol-1-yl)phenyl]benzamide.
| Compound Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[4-(tetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 2553279 |
| Molecular Formula | C22H20N6O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[4-(tetrazol-1-yl)phenyl]benzamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)Nc3ccc(-n4cnnn4)cc3)c2)cc1 |
| InChI | InChI=1S/C22H20N6O4S/c1-27(18-10-12-20(32-2)13-11-18)33(30,31)21-5-3-4-16(14-21)22(29)24-17-6-8-19(9-7-17)28-15-23-25-26-28/h3-15H,1-2H3,(H,24,29) |
| InChIKey | ZOQCIIXJIQEXFH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |