C24H24N4O5S — CID 55778587
3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]benzamide (PubChem CID 55778587) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]benzamide.
| Compound Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55778587 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]benzamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)Nc3cccc(N4CCNC4=O)c3)c2)cc1 |
| InChI | InChI=1S/C24H24N4O5S/c1-27(19-9-11-21(33-2)12-10-19)34(31,32)22-8-3-5-17(15-22)23(29)26-18-6-4-7-20(16-18)28-14-13-25-24(28)30/h3-12,15-16H,13-14H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | MGWTUXGLAUFPDP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |