C22H22N2O4S — CID 4800647
3-(dimethylsulfamoyl)-N-[4-(4-methylphenoxy)phenyl]benzamide (PubChem CID 4800647) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[4-(4-methylphenoxy)phenyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[4-(4-methylphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 4800647 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[4-(4-methylphenoxy)phenyl]benzamide |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)c3cccc(S(=O)(=O)N(C)C)c3)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c1-16-7-11-19(12-8-16)28-20-13-9-18(10-14-20)23-22(25)17-5-4-6-21(15-17)29(26,27)24(2)3/h4-15H,1-3H3,(H,23,25) |
| InChIKey | AKAMDJXFKWVKQW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |