C21H17F2NO3 — CID 7925214
3-(difluoromethoxy)-N-[4-(4-methylphenoxy)phenyl]benzamide (PubChem CID 7925214) has the molecular formula C21H17F2NO3 and a molecular weight of 369.37 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[4-(4-methylphenoxy)phenyl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-[4-(4-methylphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 7925214 |
| Molecular Formula | C21H17F2NO3 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-(difluoromethoxy)-N-[4-(4-methylphenoxy)phenyl]benzamide |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)c3cccc(OC(F)F)c3)cc2)cc1 |
| InChI | InChI=1S/C21H17F2NO3/c1-14-5-9-17(10-6-14)26-18-11-7-16(8-12-18)24-20(25)15-3-2-4-19(13-15)27-21(22)23/h2-13,21H,1H3,(H,24,25) |
| InChIKey | VQVXZEIFESRJJH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |