C19H20ClNO6 — CID 28631326
ethyl 2-chloro-4-[(3,4,5-trimethoxybenzoyl)amino]benzoate (PubChem CID 28631326) has the molecular formula C19H20ClNO6 and a molecular weight of 393.82 g/mol. Its IUPAC name is ethyl 2-chloro-4-[(3,4,5-trimethoxybenzoyl)amino]benzoate.
| Compound Name | ethyl 2-chloro-4-[(3,4,5-trimethoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 28631326 |
| Molecular Formula | C19H20ClNO6 |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | ethyl 2-chloro-4-[(3,4,5-trimethoxybenzoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C19H20ClNO6/c1-5-27-19(23)13-7-6-12(10-14(13)20)21-18(22)11-8-15(24-2)17(26-4)16(9-11)25-3/h6-10H,5H2,1-4H3,(H,21,22) |
| InChIKey | SMEADZQYQVTUQE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |