C20H20ClNO4 — CID 92683570
ethyl 2-chloro-4-[(4-methoxy-3-prop-2-enylbenzoyl)amino]benzoate (PubChem CID 92683570) has the molecular formula C20H20ClNO4 and a molecular weight of 373.84 g/mol. Its IUPAC name is ethyl 2-chloro-4-[(4-methoxy-3-prop-2-enylbenzoyl)amino]benzoate.
| Compound Name | ethyl 2-chloro-4-[(4-methoxy-3-prop-2-enylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 92683570 |
| Molecular Formula | C20H20ClNO4 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | ethyl 2-chloro-4-[(4-methoxy-3-prop-2-enylbenzoyl)amino]benzoate |
| SMILES | C=CCc1cc(C(=O)Nc2ccc(C(=O)OCC)c(Cl)c2)ccc1OC |
| InChI | InChI=1S/C20H20ClNO4/c1-4-6-13-11-14(7-10-18(13)25-3)19(23)22-15-8-9-16(17(21)12-15)20(24)26-5-2/h4,7-12H,1,5-6H2,2-3H3,(H,22,23) |
| InChIKey | CDZBTQFRIVBHHD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|