C24H29NO4S — CID 151888152
tert-butyl 4-[(4-methylsulfonylphenyl)-phenylmethylidene]piperidine-1-carboxylate (PubChem CID 151888152) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is tert-butyl 4-[(4-methylsulfonylphenyl)-phenylmethylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-methylsulfonylphenyl)-phenylmethylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 151888152 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | tert-butyl 4-[(4-methylsulfonylphenyl)-phenylmethylidene]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=C(c2ccccc2)c2ccc(S(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C24H29NO4S/c1-24(2,3)29-23(26)25-16-14-20(15-17-25)22(18-8-6-5-7-9-18)19-10-12-21(13-11-19)30(4,27)28/h5-13H,14-17H2,1-4H3 |
| InChIKey | SQDVWMWBGFNMBG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |