C30H43N3O3 — CID 142891843
tert-butyl 4-[(3-aminophenyl)-[4-(diethylcarbamoyl)phenyl]methylidene]piperidine-1-carboxylate;ethane (PubChem CID 142891843) has the molecular formula C30H43N3O3 and a molecular weight of 493.69 g/mol. Its IUPAC name is tert-butyl 4-[(3-aminophenyl)-[4-(diethylcarbamoyl)phenyl]methylidene]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[(3-aminophenyl)-[4-(diethylcarbamoyl)phenyl]methylidene]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 142891843 |
| Molecular Formula | C30H43N3O3 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.33 |
| IUPAC Name | tert-butyl 4-[(3-aminophenyl)-[4-(diethylcarbamoyl)phenyl]methylidene]piperidine-1-carboxylate;ethane |
| SMILES | CC.CCN(CC)C(=O)c1ccc(C(=C2CCN(C(=O)OC(C)(C)C)CC2)c2cccc(N)c2)cc1 |
| InChI | InChI=1S/C28H37N3O3.C2H6/c1-6-30(7-2)26(32)22-13-11-20(12-14-22)25(23-9-8-10-24(29)19-23)21-15-17-31(18-16-21)27(33)34-28(3,4)5;1-2/h8-14,19H,6-7,15-18,29H2,1-5H3;1-2H3 |
| InChIKey | TXYXJTBNTQBXQN-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|