C24H29N3O3 — CID 69475946
4-[(3-aminophenyl)-[4-(diethylcarbamoyl)phenyl]methylidene]piperidine-1-carboxylic acid (PubChem CID 69475946) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-[(3-aminophenyl)-[4-(diethylcarbamoyl)phenyl]methylidene]piperidine-1-carboxylic acid.
| Compound Name | 4-[(3-aminophenyl)-[4-(diethylcarbamoyl)phenyl]methylidene]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69475946 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 4-[(3-aminophenyl)-[4-(diethylcarbamoyl)phenyl]methylidene]piperidine-1-carboxylic acid |
| SMILES | CCN(CC)C(=O)c1ccc(C(=C2CCN(C(=O)O)CC2)c2cccc(N)c2)cc1 |
| InChI | InChI=1S/C24H29N3O3/c1-3-26(4-2)23(28)19-10-8-17(9-11-19)22(20-6-5-7-21(25)16-20)18-12-14-27(15-13-18)24(29)30/h5-11,16H,3-4,12-15,25H2,1-2H3,(H,29,30) |
| InChIKey | DNUSZJKYZBMJLR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|