C24H29IN2O3 — CID 142966945
[3-[[4-(diethylcarbamoyl)phenyl]-(1-methoxypiperidin-4-ylidene)methyl]phenyl] hypoiodite (PubChem CID 142966945) has the molecular formula C24H29IN2O3 and a molecular weight of 520.41 g/mol. Its IUPAC name is [3-[[4-(diethylcarbamoyl)phenyl]-(1-methoxypiperidin-4-ylidene)methyl]phenyl] hypoiodite.
| Compound Name | [3-[[4-(diethylcarbamoyl)phenyl]-(1-methoxypiperidin-4-ylidene)methyl]phenyl] hypoiodite |
|---|---|
| PubChem CID | 142966945 |
| Molecular Formula | C24H29IN2O3 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | [3-[[4-(diethylcarbamoyl)phenyl]-(1-methoxypiperidin-4-ylidene)methyl]phenyl] hypoiodite |
| SMILES | CCN(CC)C(=O)c1ccc(C(=C2CCN(OC)CC2)c2cccc(OI)c2)cc1 |
| InChI | InChI=1S/C24H29IN2O3/c1-4-26(5-2)24(28)20-11-9-18(10-12-20)23(19-13-15-27(29-3)16-14-19)21-7-6-8-22(17-21)30-25/h6-12,17H,4-5,13-16H2,1-3H3 |
| InChIKey | WNTMMNXXXQEDMI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|