C26H33F3N2O5S — CID 142891829
[3-[[4-(diethylcarbamoyl)phenyl]-(1-methoxypiperidin-4-ylidene)methyl]phenyl] trifluoromethanesulfonate;methane (PubChem CID 142891829) has the molecular formula C26H33F3N2O5S and a molecular weight of 542.62 g/mol. Its IUPAC name is [3-[[4-(diethylcarbamoyl)phenyl]-(1-methoxypiperidin-4-ylidene)methyl]phenyl] trifluoromethanesulfonate;methane.
| Compound Name | [3-[[4-(diethylcarbamoyl)phenyl]-(1-methoxypiperidin-4-ylidene)methyl]phenyl] trifluoromethanesulfonate;methane |
|---|---|
| PubChem CID | 142891829 |
| Molecular Formula | C26H33F3N2O5S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | [3-[[4-(diethylcarbamoyl)phenyl]-(1-methoxypiperidin-4-ylidene)methyl]phenyl] trifluoromethanesulfonate;methane |
| SMILES | C.CCN(CC)C(=O)c1ccc(C(=C2CCN(OC)CC2)c2cccc(OS(=O)(=O)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H29F3N2O5S.CH4/c1-4-29(5-2)24(31)20-11-9-18(10-12-20)23(19-13-15-30(34-3)16-14-19)21-7-6-8-22(17-21)35-36(32,33)25(26,27)28;/h6-12,17H,4-5,13-16H2,1-3H3;1H4 |
| InChIKey | GGASBVYFYHAWFP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|