C22H34N4O4 — CID 34197048
tert-butyl 4-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 34197048) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 34197048 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | tert-butyl 4-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)CN2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C22H34N4O4/c1-6-25(7-2)20(28)17-9-8-10-18(15-17)23-19(27)16-24-11-13-26(14-12-24)21(29)30-22(3,4)5/h8-10,15H,6-7,11-14,16H2,1-5H3,(H,23,27) |
| InChIKey | GHQSYBVGWLUDSY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |