C18H29N3O3 — CID 113268202
tert-butyl N-[2-[3-(diethylcarbamoyl)anilino]ethyl]carbamate (PubChem CID 113268202) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(diethylcarbamoyl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(diethylcarbamoyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 113268202 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | tert-butyl N-[2-[3-(diethylcarbamoyl)anilino]ethyl]carbamate |
| SMILES | CCN(CC)C(=O)c1cccc(NCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H29N3O3/c1-6-21(7-2)16(22)14-9-8-10-15(13-14)19-11-12-20-17(23)24-18(3,4)5/h8-10,13,19H,6-7,11-12H2,1-5H3,(H,20,23) |
| InChIKey | IZWFEAQDOPCMTC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|