C19H25N3O3S — CID 169078360
tert-butyl (1R,5S)-8-(benzoylcarbamothioyl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 169078360) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is tert-butyl (1R,5S)-8-(benzoylcarbamothioyl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | tert-butyl (1R,5S)-8-(benzoylcarbamothioyl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 169078360 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | tert-butyl (1R,5S)-8-(benzoylcarbamothioyl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC[C@@H](C1)N2C(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-19(2,3)25-18(24)21-11-14-9-10-15(12-21)22(14)17(26)20-16(23)13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3,(H,20,23,26)/t14-,15+ |
| InChIKey | SRGNCKJBEUXTEI-GASCZTMLSA-N |
| XLogP | 2.79 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|