C23H33N3O4 — CID 24575440
tert-butyl 3-(4-benzamidopiperidine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 24575440) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is tert-butyl 3-(4-benzamidopiperidine-1-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-benzamidopiperidine-1-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24575440 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | tert-butyl 3-(4-benzamidopiperidine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)N2CCC(NC(=O)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C23H33N3O4/c1-23(2,3)30-22(29)26-13-7-10-18(16-26)21(28)25-14-11-19(12-15-25)24-20(27)17-8-5-4-6-9-17/h4-6,8-9,18-19H,7,10-16H2,1-3H3,(H,24,27) |
| InChIKey | SMICVAJJMDBUJC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |