C24H28N4O3 — CID 59850228
tert-butyl 4-[(4-indazol-1-ylbenzoyl)amino]piperidine-1-carboxylate (PubChem CID 59850228) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl 4-[(4-indazol-1-ylbenzoyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-indazol-1-ylbenzoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59850228 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | tert-butyl 4-[(4-indazol-1-ylbenzoyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2ccc(-n3ncc4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C24H28N4O3/c1-24(2,3)31-23(30)27-14-12-19(13-15-27)26-22(29)17-8-10-20(11-9-17)28-21-7-5-4-6-18(21)16-25-28/h4-11,16,19H,12-15H2,1-3H3,(H,26,29) |
| InChIKey | ZEODDROGJHLQAB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |