C25H25NO5 — CID 7582643
[(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate (PubChem CID 7582643) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is [(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate.
| Compound Name | [(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|---|
| PubChem CID | 7582643 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [(2R)-1-oxo-1-piperidin-1-ylpropan-2-yl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)O[C@H](C)C(=O)N3CCCCC3)cccc2c1=O |
| InChI | InChI=1S/C25H25NO5/c1-16-21(27)19-12-9-13-20(23(19)31-22(16)18-10-5-3-6-11-18)25(29)30-17(2)24(28)26-14-7-4-8-15-26/h3,5-6,9-13,17H,4,7-8,14-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | BFOGQARHDWBCGW-QGZVFWFLSA-N |
| XLogP | 4.33 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |