C26H21NO5 — CID 41078717
[(2S)-1-anilino-1-oxopropan-2-yl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate (PubChem CID 41078717) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is [(2S)-1-anilino-1-oxopropan-2-yl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate.
| Compound Name | [(2S)-1-anilino-1-oxopropan-2-yl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|---|
| PubChem CID | 41078717 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [(2S)-1-anilino-1-oxopropan-2-yl] 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)O[C@@H](C)C(=O)Nc3ccccc3)cccc2c1=O |
| InChI | InChI=1S/C26H21NO5/c1-16-22(28)20-14-9-15-21(24(20)32-23(16)18-10-5-3-6-11-18)26(30)31-17(2)25(29)27-19-12-7-4-8-13-19/h3-15,17H,1-2H3,(H,27,29)/t17-/m0/s1 |
| InChIKey | UVWUYGHYEGWYIR-KRWDZBQOSA-N |
| XLogP | 4.95 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |