C20H17NO6 — CID 166207623
2-hydroxy-3-[(3-methyl-4-oxo-2-phenylchromene-8-carbonyl)amino]propanoic acid (PubChem CID 166207623) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-hydroxy-3-[(3-methyl-4-oxo-2-phenylchromene-8-carbonyl)amino]propanoic acid.
| Compound Name | 2-hydroxy-3-[(3-methyl-4-oxo-2-phenylchromene-8-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 166207623 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-hydroxy-3-[(3-methyl-4-oxo-2-phenylchromene-8-carbonyl)amino]propanoic acid |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)NCC(O)C(=O)O)cccc2c1=O |
| InChI | InChI=1S/C20H17NO6/c1-11-16(23)13-8-5-9-14(19(24)21-10-15(22)20(25)26)18(13)27-17(11)12-6-3-2-4-7-12/h2-9,15,22H,10H2,1H3,(H,21,24)(H,25,26) |
| InChIKey | PRVNCBSYCHYFGT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |