C21H21NO5S — CID 166187970
N-(2-ethylsulfonylethyl)-3-methyl-4-oxo-2-phenylchromene-8-carboxamide (PubChem CID 166187970) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-(2-ethylsulfonylethyl)-3-methyl-4-oxo-2-phenylchromene-8-carboxamide.
| Compound Name | N-(2-ethylsulfonylethyl)-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
|---|---|
| PubChem CID | 166187970 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-(2-ethylsulfonylethyl)-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
| SMILES | CCS(=O)(=O)CCNC(=O)c1cccc2c(=O)c(C)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C21H21NO5S/c1-3-28(25,26)13-12-22-21(24)17-11-7-10-16-18(23)14(2)19(27-20(16)17)15-8-5-4-6-9-15/h4-11H,3,12-13H2,1-2H3,(H,22,24) |
| InChIKey | PJVUQZXSLSXGSD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |