C37H36N2O3 — CID 19972443
N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide (PubChem CID 19972443) has the molecular formula C37H36N2O3 and a molecular weight of 556.71 g/mol. Its IUPAC name is N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide.
| Compound Name | N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
|---|---|
| PubChem CID | 19972443 |
| Molecular Formula | C37H36N2O3 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)NCCCN3CCC(c4ccccc4)(c4ccccc4)CC3)cccc2c1=O |
| InChI | InChI=1S/C37H36N2O3/c1-27-33(40)31-19-11-20-32(35(31)42-34(27)28-13-5-2-6-14-28)36(41)38-23-12-24-39-25-21-37(22-26-39,29-15-7-3-8-16-29)30-17-9-4-10-18-30/h2-11,13-20H,12,21-26H2,1H3,(H,38,41) |
| InChIKey | NIMDSPINUAFMMC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|