C33H38N4O4 — CID 19972731
6-(dimethylamino)-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide (PubChem CID 19972731) has the molecular formula C33H38N4O4 and a molecular weight of 554.69 g/mol. Its IUPAC name is 6-(dimethylamino)-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide.
| Compound Name | 6-(dimethylamino)-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
|---|---|
| PubChem CID | 19972731 |
| Molecular Formula | C33H38N4O4 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 6-(dimethylamino)-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
| SMILES | COc1ccccc1N1CCN(CCCNC(=O)c2cc(N(C)C)cc3c(=O)c(C)c(-c4ccccc4)oc23)CC1 |
| InChI | InChI=1S/C33H38N4O4/c1-23-30(38)26-21-25(35(2)3)22-27(32(26)41-31(23)24-11-6-5-7-12-24)33(39)34-15-10-16-36-17-19-37(20-18-36)28-13-8-9-14-29(28)40-4/h5-9,11-14,21-22H,10,15-20H2,1-4H3,(H,34,39) |
| InChIKey | VTTFQDRNGLRVKA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|