C31H38ClN3O4 — CID 67714452
8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylamino]-3-methyl-2-phenylchromen-4-one;hydrate;hydrochloride (PubChem CID 67714452) has the molecular formula C31H38ClN3O4 and a molecular weight of 552.12 g/mol. Its IUPAC name is 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylamino]-3-methyl-2-phenylchromen-4-one;hydrate;hydrochloride.
| Compound Name | 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylamino]-3-methyl-2-phenylchromen-4-one;hydrate;hydrochloride |
|---|---|
| PubChem CID | 67714452 |
| Molecular Formula | C31H38ClN3O4 |
| Molecular Weight | 552.12 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylamino]-3-methyl-2-phenylchromen-4-one;hydrate;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCCNc2cccc3c(=O)c(C)c(-c4ccccc4)oc23)CC1.Cl.O |
| InChI | InChI=1S/C31H35N3O3.ClH.H2O/c1-23-29(35)25-13-10-14-26(31(25)37-30(23)24-11-4-3-5-12-24)32-17-8-9-18-33-19-21-34(22-20-33)27-15-6-7-16-28(27)36-2;;/h3-7,10-16,32H,8-9,17-22H2,1-2H3;1H;1H2 |
| InChIKey | YAUUDQPBKFKPKD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.12 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|