C31H32N2O3S — CID 174295064
8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-4-sulfanylidenebutyl]-3-methyl-2-phenylchromen-4-one (PubChem CID 174295064) has the molecular formula C31H32N2O3S and a molecular weight of 512.68 g/mol. Its IUPAC name is 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-4-sulfanylidenebutyl]-3-methyl-2-phenylchromen-4-one.
| Compound Name | 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-4-sulfanylidenebutyl]-3-methyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 174295064 |
| Molecular Formula | C31H32N2O3S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-4-sulfanylidenebutyl]-3-methyl-2-phenylchromen-4-one |
| SMILES | COc1ccccc1N1CCN(C(=S)CCCc2cccc3c(=O)c(C)c(-c4ccccc4)oc23)CC1 |
| InChI | InChI=1S/C31H32N2O3S/c1-22-29(34)25-14-8-12-24(31(25)36-30(22)23-10-4-3-5-11-23)13-9-17-28(37)33-20-18-32(19-21-33)26-15-6-7-16-27(26)35-2/h3-8,10-12,14-16H,9,13,17-21H2,1-2H3 |
| InChIKey | RUXFRGRELCLGHD-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|