C31H32N2O3 — CID 19972634
8-[(E)-4-[4-(2-methoxyphenyl)piperazin-1-yl]but-1-enyl]-3-methyl-2-phenylchromen-4-one (PubChem CID 19972634) has the molecular formula C31H32N2O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is 8-[(E)-4-[4-(2-methoxyphenyl)piperazin-1-yl]but-1-enyl]-3-methyl-2-phenylchromen-4-one.
| Compound Name | 8-[(E)-4-[4-(2-methoxyphenyl)piperazin-1-yl]but-1-enyl]-3-methyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 19972634 |
| Molecular Formula | C31H32N2O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 8-[(E)-4-[4-(2-methoxyphenyl)piperazin-1-yl]but-1-enyl]-3-methyl-2-phenylchromen-4-one |
| SMILES | COc1ccccc1N1CCN(CC/C=C/c2cccc3c(=O)c(C)c(-c4ccccc4)oc23)CC1 |
| InChI | InChI=1S/C31H32N2O3/c1-23-29(34)26-15-10-14-25(31(26)36-30(23)24-11-4-3-5-12-24)13-8-9-18-32-19-21-33(22-20-32)27-16-6-7-17-28(27)35-2/h3-8,10-17H,9,18-22H2,1-2H3/b13-8+ |
| InChIKey | XIRPNHGMMUAPCN-MDWZMJQESA-N |
| XLogP | 6.00 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |