C31H34N2O4S — CID 10459669
8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylsulfinyl]-3-methyl-2-phenylchromen-4-one (PubChem CID 10459669) has the molecular formula C31H34N2O4S and a molecular weight of 530.69 g/mol. Its IUPAC name is 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylsulfinyl]-3-methyl-2-phenylchromen-4-one.
| Compound Name | 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylsulfinyl]-3-methyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 10459669 |
| Molecular Formula | C31H34N2O4S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 8-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylsulfinyl]-3-methyl-2-phenylchromen-4-one |
| SMILES | COc1ccccc1N1CCN(CCCCS(=O)c2cccc3c(=O)c(C)c(-c4ccccc4)oc23)CC1 |
| InChI | InChI=1S/C31H34N2O4S/c1-23-29(34)25-13-10-16-28(31(25)37-30(23)24-11-4-3-5-12-24)38(35)22-9-8-17-32-18-20-33(21-19-32)26-14-6-7-15-27(26)36-2/h3-7,10-16H,8-9,17-22H2,1-2H3 |
| InChIKey | QCGUXTXLFNMPQT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|