C29H30N2O5 — CID 19972581
N-[3-[2-(2-methoxyphenoxy)ethylamino]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide (PubChem CID 19972581) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is N-[3-[2-(2-methoxyphenoxy)ethylamino]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide.
| Compound Name | N-[3-[2-(2-methoxyphenoxy)ethylamino]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
|---|---|
| PubChem CID | 19972581 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | N-[3-[2-(2-methoxyphenoxy)ethylamino]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
| SMILES | COc1ccccc1OCCNCCCNC(=O)c1cccc2c(=O)c(C)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C29H30N2O5/c1-20-26(32)22-12-8-13-23(28(22)36-27(20)21-10-4-3-5-11-21)29(33)31-17-9-16-30-18-19-35-25-15-7-6-14-24(25)34-2/h3-8,10-15,30H,9,16-19H2,1-2H3,(H,31,33) |
| InChIKey | KDLDDFQFOSUQGH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|