C28H30ClNO5 — CID 24835332
8-[2-[2-(2,6-dimethoxyphenyl)ethylamino]ethoxy]-3-methyl-2-phenylchromen-4-one;hydrochloride (PubChem CID 24835332) has the molecular formula C28H30ClNO5 and a molecular weight of 496.00 g/mol. Its IUPAC name is 8-[2-[2-(2,6-dimethoxyphenyl)ethylamino]ethoxy]-3-methyl-2-phenylchromen-4-one;hydrochloride.
| Compound Name | 8-[2-[2-(2,6-dimethoxyphenyl)ethylamino]ethoxy]-3-methyl-2-phenylchromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 24835332 |
| Molecular Formula | C28H30ClNO5 |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 8-[2-[2-(2,6-dimethoxyphenyl)ethylamino]ethoxy]-3-methyl-2-phenylchromen-4-one;hydrochloride |
| SMILES | COc1cccc(OC)c1CCNCCOc1cccc2c(=O)c(C)c(-c3ccccc3)oc12.Cl |
| InChI | InChI=1S/C28H29NO5.ClH/c1-19-26(30)22-11-7-14-25(28(22)34-27(19)20-9-5-4-6-10-20)33-18-17-29-16-15-21-23(31-2)12-8-13-24(21)32-3;/h4-14,29H,15-18H2,1-3H3;1H |
| InChIKey | YSUQPGYINJUTLA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|