C28H23N3O3 — CID 16606726
3-methyl-4-oxo-2-phenyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]chromene-8-carboxamide (PubChem CID 16606726) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 3-methyl-4-oxo-2-phenyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]chromene-8-carboxamide.
| Compound Name | 3-methyl-4-oxo-2-phenyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]chromene-8-carboxamide |
|---|---|
| PubChem CID | 16606726 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-methyl-4-oxo-2-phenyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]chromene-8-carboxamide |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)NCCc3cnn(-c4ccccc4)c3)cccc2c1=O |
| InChI | InChI=1S/C28H23N3O3/c1-19-25(32)23-13-8-14-24(27(23)34-26(19)21-9-4-2-5-10-21)28(33)29-16-15-20-17-30-31(18-20)22-11-6-3-7-12-22/h2-14,17-18H,15-16H2,1H3,(H,29,33) |
| InChIKey | GAABILBDDBCCFN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |