About 2-morpholin-4-ylethyl 2-iodobenzoate
2-morpholin-4-ylethyl 2-iodobenzoate (PubChem CID 989917) has the molecular formula C13H16INO3
and a molecular weight of 361.18 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 2-iodobenzoate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 2-iodobenzoate |
| PubChem CID | 989917 |
| Molecular Formula | C13H16INO3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2-morpholin-4-ylethyl 2-iodobenzoate |
| SMILES | O=C(OCCN1CCOCC1)c1ccccc1I |
| InChI | InChI=1S/C13H16INO3/c14-12-4-2-1-3-11(12)13(16)18-10-7-15-5-8-17-9-6-15/h1-4H,5-10H2 |
| InChIKey | BWTGWLIPVCMJDD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ylethyl 2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 2-iodobenzoate?
The IUPAC name of 2-morpholin-4-ylethyl 2-iodobenzoate (CID 989917) is 2-morpholin-4-ylethyl 2-iodobenzoate.
What is the SMILES notation for 2-morpholin-4-ylethyl 2-iodobenzoate?
The canonical SMILES for 2-morpholin-4-ylethyl 2-iodobenzoate is O=C(OCCN1CCOCC1)c1ccccc1I.
What is the InChIKey of 2-morpholin-4-ylethyl 2-iodobenzoate?
The InChIKey is BWTGWLIPVCMJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16INO3/c14-12-4-2-1-3-11(12)13(16)18-10-7-15-5-8-17-9-6-15/h1-4H,5-10H2.
What are the key properties of 2-morpholin-4-ylethyl 2-iodobenzoate?
2-morpholin-4-ylethyl 2-iodobenzoate has a molecular weight of 361.18 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 2-iodobenzoate is sourced from PubChem (CID 989917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).